C9H15F3N4O2S — CID 115515239
5-amino-3-methyl-N-(5,5,5-trifluoropentyl)imidazole-4-sulfonamide (PubChem CID 115515239) has the molecular formula C9H15F3N4O2S and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-amino-3-methyl-N-(5,5,5-trifluoropentyl)imidazole-4-sulfonamide.
| Compound Name | 5-amino-3-methyl-N-(5,5,5-trifluoropentyl)imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 115515239 |
| Molecular Formula | C9H15F3N4O2S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 5-amino-3-methyl-N-(5,5,5-trifluoropentyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(N)c1S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4O2S/c1-16-6-14-7(13)8(16)19(17,18)15-5-3-2-4-9(10,11)12/h6,15H,2-5,13H2,1H3 |
| InChIKey | LKVYSGQLKKNNPV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|