C12H14F3N3S — CID 115515505
5-N-(5,5,5-trifluoropentyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 115515505) has the molecular formula C12H14F3N3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-N-(5,5,5-trifluoropentyl)-1,3-benzothiazole-4,5-diamine.
| Compound Name | 5-N-(5,5,5-trifluoropentyl)-1,3-benzothiazole-4,5-diamine |
|---|---|
| PubChem CID | 115515505 |
| Molecular Formula | C12H14F3N3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 5-N-(5,5,5-trifluoropentyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | Nc1c(NCCCCC(F)(F)F)ccc2scnc12 |
| InChI | InChI=1S/C12H14F3N3S/c13-12(14,15)5-1-2-6-17-8-3-4-9-11(10(8)16)18-7-19-9/h3-4,7,17H,1-2,5-6,16H2 |
| InChIKey | YJDQGUAWMQUFDV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|