C11H20F3NO — CID 115515696
1,2-dimethyl-4-(4,4,4-trifluorobutyl)piperidin-4-ol (PubChem CID 115515696) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 1,2-dimethyl-4-(4,4,4-trifluorobutyl)piperidin-4-ol.
| Compound Name | 1,2-dimethyl-4-(4,4,4-trifluorobutyl)piperidin-4-ol |
|---|---|
| PubChem CID | 115515696 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1,2-dimethyl-4-(4,4,4-trifluorobutyl)piperidin-4-ol |
| SMILES | CC1CC(O)(CCCC(F)(F)F)CCN1C |
| InChI | InChI=1S/C11H20F3NO/c1-9-8-10(16,6-7-15(9)2)4-3-5-11(12,13)14/h9,16H,3-8H2,1-2H3 |
| InChIKey | DWGALMPLHBTESU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |