C11H14F3NO5S — CID 115515782
2,5-dimethyl-4-(4,4,4-trifluorobutylsulfamoyl)furan-3-carboxylic acid (PubChem CID 115515782) has the molecular formula C11H14F3NO5S and a molecular weight of 329.30 g/mol. Its IUPAC name is 2,5-dimethyl-4-(4,4,4-trifluorobutylsulfamoyl)furan-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-4-(4,4,4-trifluorobutylsulfamoyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 115515782 |
| Molecular Formula | C11H14F3NO5S |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2,5-dimethyl-4-(4,4,4-trifluorobutylsulfamoyl)furan-3-carboxylic acid |
| SMILES | Cc1oc(C)c(S(=O)(=O)NCCCC(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C11H14F3NO5S/c1-6-8(10(16)17)9(7(2)20-6)21(18,19)15-5-3-4-11(12,13)14/h15H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | RKKCYHNFXYQLFI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|