C16H14N4O4 — CID 11551583
6-benzyl-5-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 11551583) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 6-benzyl-5-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-benzyl-5-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11551583 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 6-benzyl-5-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1[nH]cc(Cc2c(Cc3ccccc3)[nH]c(=O)[nH]c2=O)c(=O)[nH]1 |
| InChI | InChI=1S/C16H14N4O4/c21-13-10(8-17-15(23)19-13)7-11-12(18-16(24)20-14(11)22)6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,17,19,21,23)(H2,18,20,22,24) |
| InChIKey | CFQZYAUCRGNWAA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |