C11H16F3N3O2 — CID 115516016
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 115516016) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 115516016 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | COc1ncnc(OC)c1CNCCCC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O2/c1-18-9-8(10(19-2)17-7-16-9)6-15-5-3-4-11(12,13)14/h7,15H,3-6H2,1-2H3 |
| InChIKey | IQMYRCOMQAPAAY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|