C14H21F3N2 — CID 115516070
4,4,4-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]butan-1-amine (PubChem CID 115516070) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]butan-1-amine.
| Compound Name | 4,4,4-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 115516070 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-(2,4,6-trimethyl-3-pyridinyl)ethyl]butan-1-amine |
| SMILES | Cc1cc(C)c(C(C)NCCCC(F)(F)F)c(C)n1 |
| InChI | InChI=1S/C14H21F3N2/c1-9-8-10(2)19-12(4)13(9)11(3)18-7-5-6-14(15,16)17/h8,11,18H,5-7H2,1-4H3 |
| InChIKey | PPUOLHFQRLMZIV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|