About 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol
1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol (PubChem CID 115516110) has the molecular formula C10H19F3OS
and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol |
| PubChem CID | 115516110 |
| Molecular Formula | C10H19F3OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol |
| SMILES | CC(C)(C)SCC(O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H19F3OS/c1-9(2,3)15-7-8(14)5-4-6-10(11,12)13/h8,14H,4-7H2,1-3H3 |
| InChIKey | KWNNCABSANODTJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol?
The IUPAC name of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol (CID 115516110) is 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol.
What is the SMILES notation for 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol?
The canonical SMILES for 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol is CC(C)(C)SCC(O)CCCC(F)(F)F.
What is the InChIKey of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol?
The InChIKey is KWNNCABSANODTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3OS/c1-9(2,3)15-7-8(14)5-4-6-10(11,12)13/h8,14H,4-7H2,1-3H3.
What are the key properties of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol?
1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol has a molecular weight of 244.32 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-ol is sourced from PubChem (CID 115516110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).