About 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol
1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol (PubChem CID 115516126) has the molecular formula C8H12F3N3O
and a molecular weight of 223.20 g/mol. Its IUPAC name is 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol.
Molecular Properties
| Compound Name | 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol |
| PubChem CID | 115516126 |
| Molecular Formula | C8H12F3N3O |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol |
| SMILES | Nc1[nH]ncc1C(O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O/c9-8(10,11)3-1-2-6(15)5-4-13-14-7(5)12/h4,6,15H,1-3H2,(H3,12,13,14) |
| InChIKey | WXOQVTBCFTTWNZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol?
The IUPAC name of 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol (CID 115516126) is 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol.
What is the SMILES notation for 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol?
The canonical SMILES for 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol is Nc1[nH]ncc1C(O)CCCC(F)(F)F.
What is the InChIKey of 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol?
The InChIKey is WXOQVTBCFTTWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N3O/c9-8(10,11)3-1-2-6(15)5-4-13-14-7(5)12/h4,6,15H,1-3H2,(H3,12,13,14).
What are the key properties of 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol?
1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol has a molecular weight of 223.20 g/mol, XLogP of 1.76, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-1H-pyrazol-4-yl)-5,5,5-trifluoropentan-1-ol is sourced from PubChem (CID 115516126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).