C14H28F3NO — CID 115516163
3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol (PubChem CID 115516163) has the molecular formula C14H28F3NO and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol.
| Compound Name | 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol |
|---|---|
| PubChem CID | 115516163 |
| Molecular Formula | C14H28F3NO |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol |
| SMILES | CCN(CC)C(CC)(CC)C(O)CCCC(F)(F)F |
| InChI | InChI=1S/C14H28F3NO/c1-5-13(6-2,18(7-3)8-4)12(19)10-9-11-14(15,16)17/h12,19H,5-11H2,1-4H3 |
| InChIKey | HIRDEWIJJNVTCN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |