About 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol
3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol (PubChem CID 115516163) has the molecular formula C14H28F3NO
and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol.
Molecular Properties
| Compound Name | 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol |
| PubChem CID | 115516163 |
| Molecular Formula | C14H28F3NO |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol |
| SMILES | CCN(CC)C(CC)(CC)C(O)CCCC(F)(F)F |
| InChI | InChI=1S/C14H28F3NO/c1-5-13(6-2,18(7-3)8-4)12(19)10-9-11-14(15,16)17/h12,19H,5-11H2,1-4H3 |
| InChIKey | HIRDEWIJJNVTCN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol?
The IUPAC name of 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol (CID 115516163) is 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol.
What is the SMILES notation for 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol?
The canonical SMILES for 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol is CCN(CC)C(CC)(CC)C(O)CCCC(F)(F)F.
What is the InChIKey of 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol?
The InChIKey is HIRDEWIJJNVTCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28F3NO/c1-5-13(6-2,18(7-3)8-4)12(19)10-9-11-14(15,16)17/h12,19H,5-11H2,1-4H3.
What are the key properties of 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol?
3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol has a molecular weight of 283.38 g/mol, XLogP of 3.98, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)-3-ethyl-8,8,8-trifluorooctan-4-ol is sourced from PubChem (CID 115516163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).