About 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol
1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol (PubChem CID 115516173) has the molecular formula C14H26F3NO
and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol.
Molecular Properties
| Compound Name | 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol |
| PubChem CID | 115516173 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol |
| SMILES | CC1CCC(C(O)CCCC(F)(F)F)(N(C)C)CC1 |
| InChI | InChI=1S/C14H26F3NO/c1-11-6-9-13(10-7-11,18(2)3)12(19)5-4-8-14(15,16)17/h11-12,19H,4-10H2,1-3H3 |
| InChIKey | CXEWZKDNGFCVOI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol?
The IUPAC name of 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol (CID 115516173) is 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol.
What is the SMILES notation for 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol?
The canonical SMILES for 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol is CC1CCC(C(O)CCCC(F)(F)F)(N(C)C)CC1.
What is the InChIKey of 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol?
The InChIKey is CXEWZKDNGFCVOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F3NO/c1-11-6-9-13(10-7-11,18(2)3)12(19)5-4-8-14(15,16)17/h11-12,19H,4-10H2,1-3H3.
What are the key properties of 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol?
1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol has a molecular weight of 281.36 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(dimethylamino)-4-methylcyclohexyl]-5,5,5-trifluoropentan-1-ol is sourced from PubChem (CID 115516173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).