C12H16F3N3S — CID 115516394
N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 115516394) has the molecular formula C12H16F3N3S and a molecular weight of 291.34 g/mol. Its IUPAC name is N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 115516394 |
| Molecular Formula | C12H16F3N3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | Cc1nc2scc(C)n2c1CNCCCC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3S/c1-8-7-19-11-17-9(2)10(18(8)11)6-16-5-3-4-12(13,14)15/h7,16H,3-6H2,1-2H3 |
| InChIKey | PLGJSESFIRGTQF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|