About 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine
1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine (PubChem CID 115516888) has the molecular formula C10H20F3NS
and a molecular weight of 243.34 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine.
Molecular Properties
| Compound Name | 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine |
| PubChem CID | 115516888 |
| Molecular Formula | C10H20F3NS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine |
| SMILES | CC(C)(C)SCC(N)CCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NS/c1-9(2,3)15-7-8(14)5-4-6-10(11,12)13/h8H,4-7,14H2,1-3H3 |
| InChIKey | TWZLVGAYXTZDHF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine?
The IUPAC name of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine (CID 115516888) is 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine.
What is the SMILES notation for 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine?
The canonical SMILES for 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine is CC(C)(C)SCC(N)CCCC(F)(F)F.
What is the InChIKey of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine?
The InChIKey is TWZLVGAYXTZDHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NS/c1-9(2,3)15-7-8(14)5-4-6-10(11,12)13/h8H,4-7,14H2,1-3H3.
What are the key properties of 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine?
1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine has a molecular weight of 243.34 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylsulfanyl-6,6,6-trifluorohexan-2-amine is sourced from PubChem (CID 115516888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).