About 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine
3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine (PubChem CID 115517006) has the molecular formula C16H22F3N
and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine |
| PubChem CID | 115517006 |
| Molecular Formula | C16H22F3N |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine |
| SMILES | Cc1cccc(C2CC(NCCCCC(F)(F)F)C2)c1 |
| InChI | InChI=1S/C16H22F3N/c1-12-5-4-6-13(9-12)14-10-15(11-14)20-8-3-2-7-16(17,18)19/h4-6,9,14-15,20H,2-3,7-8,10-11H2,1H3 |
| InChIKey | NOSRLYSHKBIVJV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine?
The IUPAC name of 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine (CID 115517006) is 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine.
What is the SMILES notation for 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine?
The canonical SMILES for 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine is Cc1cccc(C2CC(NCCCCC(F)(F)F)C2)c1.
What is the InChIKey of 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine?
The InChIKey is NOSRLYSHKBIVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F3N/c1-12-5-4-6-13(9-12)14-10-15(11-14)20-8-3-2-7-16(17,18)19/h4-6,9,14-15,20H,2-3,7-8,10-11H2,1H3.
What are the key properties of 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine?
3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine has a molecular weight of 285.35 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylphenyl)-N-(5,5,5-trifluoropentyl)cyclobutan-1-amine is sourced from PubChem (CID 115517006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).