C12H15ClF3NS — CID 115517160
2-chloro-N-(5,5,5-trifluoropentyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 115517160) has the molecular formula C12H15ClF3NS and a molecular weight of 297.77 g/mol. Its IUPAC name is 2-chloro-N-(5,5,5-trifluoropentyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
| Compound Name | 2-chloro-N-(5,5,5-trifluoropentyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
|---|---|
| PubChem CID | 115517160 |
| Molecular Formula | C12H15ClF3NS |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-chloro-N-(5,5,5-trifluoropentyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | FC(F)(F)CCCCNC1CCc2sc(Cl)cc21 |
| InChI | InChI=1S/C12H15ClF3NS/c13-11-7-8-9(3-4-10(8)18-11)17-6-2-1-5-12(14,15)16/h7,9,17H,1-6H2 |
| InChIKey | ZPWUDLGOHLVWCF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|