C14H24F3NO — CID 115517263
8,8-dimethyl-N-(5,5,5-trifluoropentyl)-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 115517263) has the molecular formula C14H24F3NO and a molecular weight of 279.35 g/mol. Its IUPAC name is 8,8-dimethyl-N-(5,5,5-trifluoropentyl)-2-oxabicyclo[4.2.0]octan-7-amine.
| Compound Name | 8,8-dimethyl-N-(5,5,5-trifluoropentyl)-2-oxabicyclo[4.2.0]octan-7-amine |
|---|---|
| PubChem CID | 115517263 |
| Molecular Formula | C14H24F3NO |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 8,8-dimethyl-N-(5,5,5-trifluoropentyl)-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | CC1(C)C(NCCCCC(F)(F)F)C2CCCOC21 |
| InChI | InChI=1S/C14H24F3NO/c1-13(2)11(10-6-5-9-19-12(10)13)18-8-4-3-7-14(15,16)17/h10-12,18H,3-9H2,1-2H3 |
| InChIKey | APAJJIGHQVJJBP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|