C13H18F3N3S — CID 115517287
N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115517287) has the molecular formula C13H18F3N3S and a molecular weight of 305.37 g/mol. Its IUPAC name is N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115517287 |
| Molecular Formula | C13H18F3N3S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | Cc1nc2scc(C)n2c1CNCCCCC(F)(F)F |
| InChI | InChI=1S/C13H18F3N3S/c1-9-8-20-12-18-10(2)11(19(9)12)7-17-6-4-3-5-13(14,15)16/h8,17H,3-7H2,1-2H3 |
| InChIKey | BVFARKOGEAUFAS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|