C12H22F3NS — CID 115517503
N-ethyl-5,5,5-trifluoro-1-(thian-2-yl)pentan-1-amine (PubChem CID 115517503) has the molecular formula C12H22F3NS and a molecular weight of 269.38 g/mol. Its IUPAC name is N-ethyl-5,5,5-trifluoro-1-(thian-2-yl)pentan-1-amine.
| Compound Name | N-ethyl-5,5,5-trifluoro-1-(thian-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 115517503 |
| Molecular Formula | C12H22F3NS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-ethyl-5,5,5-trifluoro-1-(thian-2-yl)pentan-1-amine |
| SMILES | CCNC(CCCC(F)(F)F)C1CCCCS1 |
| InChI | InChI=1S/C12H22F3NS/c1-2-16-10(6-5-8-12(13,14)15)11-7-3-4-9-17-11/h10-11,16H,2-9H2,1H3 |
| InChIKey | ALSFFXQTHLQNNO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |