C7H11F3O3S — CID 115517790
2-(4,4,4-trifluorobutylsulfinyl)propanoic acid (PubChem CID 115517790) has the molecular formula C7H11F3O3S and a molecular weight of 232.22 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylsulfinyl)propanoic acid.
| Compound Name | 2-(4,4,4-trifluorobutylsulfinyl)propanoic acid |
|---|---|
| PubChem CID | 115517790 |
| Molecular Formula | C7H11F3O3S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-(4,4,4-trifluorobutylsulfinyl)propanoic acid |
| SMILES | CC(C(=O)O)S(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C7H11F3O3S/c1-5(6(11)12)14(13)4-2-3-7(8,9)10/h5H,2-4H2,1H3,(H,11,12) |
| InChIKey | VKYDITNBXNKDKR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |