C9H10BrF3N2O — CID 115517829
5-bromo-2-methyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one (PubChem CID 115517829) has the molecular formula C9H10BrF3N2O and a molecular weight of 299.09 g/mol. Its IUPAC name is 5-bromo-2-methyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one.
| Compound Name | 5-bromo-2-methyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 115517829 |
| Molecular Formula | C9H10BrF3N2O |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 5-bromo-2-methyl-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
| SMILES | Cc1ncc(Br)c(=O)n1CCCC(F)(F)F |
| InChI | InChI=1S/C9H10BrF3N2O/c1-6-14-5-7(10)8(16)15(6)4-2-3-9(11,12)13/h5H,2-4H2,1H3 |
| InChIKey | MNCZLEMQFXBOAH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |