About 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one
5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one (PubChem CID 115517830) has the molecular formula C8H8F3IN2O
and a molecular weight of 332.06 g/mol. Its IUPAC name is 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
| PubChem CID | 115517830 |
| Molecular Formula | C8H8F3IN2O |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one |
| SMILES | O=c1c(I)cncn1CCCC(F)(F)F |
| InChI | InChI=1S/C8H8F3IN2O/c9-8(10,11)2-1-3-14-5-13-4-6(12)7(14)15/h4-5H,1-3H2 |
| InChIKey | YEFWECKGVSCXKI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one?
The IUPAC name of 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one (CID 115517830) is 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one.
What is the SMILES notation for 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one?
The canonical SMILES for 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one is O=c1c(I)cncn1CCCC(F)(F)F.
What is the InChIKey of 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one?
The InChIKey is YEFWECKGVSCXKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3IN2O/c9-8(10,11)2-1-3-14-5-13-4-6(12)7(14)15/h4-5H,1-3H2.
What are the key properties of 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one?
5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one has a molecular weight of 332.06 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-3-(4,4,4-trifluorobutyl)pyrimidin-4-one is sourced from PubChem (CID 115517830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).