C10H12BrF3N2O — CID 115517834
5-bromo-4,6-dimethyl-1-(4,4,4-trifluorobutyl)pyrimidin-2-one (PubChem CID 115517834) has the molecular formula C10H12BrF3N2O and a molecular weight of 313.12 g/mol. Its IUPAC name is 5-bromo-4,6-dimethyl-1-(4,4,4-trifluorobutyl)pyrimidin-2-one.
| Compound Name | 5-bromo-4,6-dimethyl-1-(4,4,4-trifluorobutyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 115517834 |
| Molecular Formula | C10H12BrF3N2O |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 5-bromo-4,6-dimethyl-1-(4,4,4-trifluorobutyl)pyrimidin-2-one |
| SMILES | Cc1nc(=O)n(CCCC(F)(F)F)c(C)c1Br |
| InChI | InChI=1S/C10H12BrF3N2O/c1-6-8(11)7(2)16(9(17)15-6)5-3-4-10(12,13)14/h3-5H2,1-2H3 |
| InChIKey | IPXHOXZOUOMDIK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |