C8H9ClF3N3OS — CID 115517942
5-chloro-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 115517942) has the molecular formula C8H9ClF3N3OS and a molecular weight of 287.69 g/mol. Its IUPAC name is 5-chloro-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-chloro-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 115517942 |
| Molecular Formula | C8H9ClF3N3OS |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 5-chloro-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1nnc(Cl)s1 |
| InChI | InChI=1S/C8H9ClF3N3OS/c9-7-15-14-6(17-7)5(16)13-4-2-1-3-8(10,11)12/h1-4H2,(H,13,16) |
| InChIKey | VJGUACICUOBBKB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|