C13H14F3N3O — CID 115518165
2-[(4,4,4-trifluorobutylamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 115518165) has the molecular formula C13H14F3N3O and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-[(4,4,4-trifluorobutylamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(4,4,4-trifluorobutylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115518165 |
| Molecular Formula | C13H14F3N3O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[(4,4,4-trifluorobutylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCCCC(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C13H14F3N3O/c14-13(15,16)5-3-6-17-9-10-8-12(20)19-7-2-1-4-11(19)18-10/h1-2,4,7-8,17H,3,5-6,9H2 |
| InChIKey | VEZHEQYZEHRZKA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|