C17H16FN5O2 — CID 11551861
1-[3-fluoro-5-[(3-methyl-2-oxoimidazol-1-yl)methyl]phenyl]-3-pyridin-3-ylurea (PubChem CID 11551861) has the molecular formula C17H16FN5O2 and a molecular weight of 341.35 g/mol. Its IUPAC name is 1-[3-fluoro-5-[(3-methyl-2-oxoimidazol-1-yl)methyl]phenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[3-fluoro-5-[(3-methyl-2-oxoimidazol-1-yl)methyl]phenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 11551861 |
| Molecular Formula | C17H16FN5O2 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-[3-fluoro-5-[(3-methyl-2-oxoimidazol-1-yl)methyl]phenyl]-3-pyridin-3-ylurea |
| SMILES | Cn1ccn(Cc2cc(F)cc(NC(=O)Nc3cccnc3)c2)c1=O |
| InChI | InChI=1S/C17H16FN5O2/c1-22-5-6-23(17(22)25)11-12-7-13(18)9-15(8-12)21-16(24)20-14-3-2-4-19-10-14/h2-10H,11H2,1H3,(H2,20,21,24) |
| InChIKey | ZOLXEEHXERVFNR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |