C15H22F3NS — CID 115518625
2-methyl-N-[[3-(4,4,4-trifluorobutylsulfanyl)phenyl]methyl]propan-1-amine (PubChem CID 115518625) has the molecular formula C15H22F3NS and a molecular weight of 305.41 g/mol. Its IUPAC name is 2-methyl-N-[[3-(4,4,4-trifluorobutylsulfanyl)phenyl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[3-(4,4,4-trifluorobutylsulfanyl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115518625 |
| Molecular Formula | C15H22F3NS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-methyl-N-[[3-(4,4,4-trifluorobutylsulfanyl)phenyl]methyl]propan-1-amine |
| SMILES | CC(C)CNCc1cccc(SCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3NS/c1-12(2)10-19-11-13-5-3-6-14(9-13)20-8-4-7-15(16,17)18/h3,5-6,9,12,19H,4,7-8,10-11H2,1-2H3 |
| InChIKey | PDKKEWWTGJMMSJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|