C12H21F3N2O2 — CID 115518666
N-(oxan-4-yl)-2-(5,5,5-trifluoropentylamino)acetamide (PubChem CID 115518666) has the molecular formula C12H21F3N2O2 and a molecular weight of 282.31 g/mol. Its IUPAC name is N-(oxan-4-yl)-2-(5,5,5-trifluoropentylamino)acetamide.
| Compound Name | N-(oxan-4-yl)-2-(5,5,5-trifluoropentylamino)acetamide |
|---|---|
| PubChem CID | 115518666 |
| Molecular Formula | C12H21F3N2O2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-(oxan-4-yl)-2-(5,5,5-trifluoropentylamino)acetamide |
| SMILES | O=C(CNCCCCC(F)(F)F)NC1CCOCC1 |
| InChI | InChI=1S/C12H21F3N2O2/c13-12(14,15)5-1-2-6-16-9-11(18)17-10-3-7-19-8-4-10/h10,16H,1-9H2,(H,17,18) |
| InChIKey | IDRVQQCPQJVUDC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|