About 3-methylsulfanyl-1,4,5-triphenylpyrazole
3-methylsulfanyl-1,4,5-triphenylpyrazole (PubChem CID 11551885) has the molecular formula C22H18N2S
and a molecular weight of 342.47 g/mol. Its IUPAC name is 3-methylsulfanyl-1,4,5-triphenylpyrazole.
Molecular Properties
| Compound Name | 3-methylsulfanyl-1,4,5-triphenylpyrazole |
| PubChem CID | 11551885 |
| Molecular Formula | C22H18N2S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-methylsulfanyl-1,4,5-triphenylpyrazole |
| SMILES | CSc1nn(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H18N2S/c1-25-22-20(17-11-5-2-6-12-17)21(18-13-7-3-8-14-18)24(23-22)19-15-9-4-10-16-19/h2-16H,1H3 |
| InChIKey | ONUQNWNEUXWCQG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylsulfanyl-1,4,5-triphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanyl-1,4,5-triphenylpyrazole?
The IUPAC name of 3-methylsulfanyl-1,4,5-triphenylpyrazole (CID 11551885) is 3-methylsulfanyl-1,4,5-triphenylpyrazole.
What is the SMILES notation for 3-methylsulfanyl-1,4,5-triphenylpyrazole?
The canonical SMILES for 3-methylsulfanyl-1,4,5-triphenylpyrazole is CSc1nn(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 3-methylsulfanyl-1,4,5-triphenylpyrazole?
The InChIKey is ONUQNWNEUXWCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2S/c1-25-22-20(17-11-5-2-6-12-17)21(18-13-7-3-8-14-18)24(23-22)19-15-9-4-10-16-19/h2-16H,1H3.
What are the key properties of 3-methylsulfanyl-1,4,5-triphenylpyrazole?
3-methylsulfanyl-1,4,5-triphenylpyrazole has a molecular weight of 342.47 g/mol, XLogP of 5.93, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanyl-1,4,5-triphenylpyrazole is sourced from PubChem (CID 11551885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).