About 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole
4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole (PubChem CID 115519638) has the molecular formula C11H18F3N3O2
and a molecular weight of 281.28 g/mol. Its IUPAC name is 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole.
Molecular Properties
| Compound Name | 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole |
| PubChem CID | 115519638 |
| Molecular Formula | C11H18F3N3O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole |
| SMILES | CCOC(OCC)c1cn(CCCC(F)(F)F)nn1 |
| InChI | InChI=1S/C11H18F3N3O2/c1-3-18-10(19-4-2)9-8-17(16-15-9)7-5-6-11(12,13)14/h8,10H,3-7H2,1-2H3 |
| InChIKey | NIYQLIAUYGDUTH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole?
The IUPAC name of 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole (CID 115519638) is 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole.
What is the SMILES notation for 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole?
The canonical SMILES for 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole is CCOC(OCC)c1cn(CCCC(F)(F)F)nn1.
What is the InChIKey of 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole?
The InChIKey is NIYQLIAUYGDUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3N3O2/c1-3-18-10(19-4-2)9-8-17(16-15-9)7-5-6-11(12,13)14/h8,10H,3-7H2,1-2H3.
What are the key properties of 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole?
4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole has a molecular weight of 281.28 g/mol, XLogP of 2.69, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxymethyl)-1-(4,4,4-trifluorobutyl)triazole is sourced from PubChem (CID 115519638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).