About 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide
2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide (PubChem CID 115519660) has the molecular formula C14H23F3N2O
and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide.
Molecular Properties
| Compound Name | 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide |
| PubChem CID | 115519660 |
| Molecular Formula | C14H23F3N2O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide |
| SMILES | CCCC(C#N)(CCC)C(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C14H23F3N2O/c1-3-7-13(11-18,8-4-2)12(20)19-10-6-5-9-14(15,16)17/h3-10H2,1-2H3,(H,19,20) |
| InChIKey | BHHZMMIZUGIZCP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide?
The IUPAC name of 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide (CID 115519660) is 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide.
What is the SMILES notation for 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide?
The canonical SMILES for 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide is CCCC(C#N)(CCC)C(=O)NCCCCC(F)(F)F.
What is the InChIKey of 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide?
The InChIKey is BHHZMMIZUGIZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F3N2O/c1-3-7-13(11-18,8-4-2)12(20)19-10-6-5-9-14(15,16)17/h3-10H2,1-2H3,(H,19,20).
What are the key properties of 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide?
2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide has a molecular weight of 292.34 g/mol, XLogP of 3.95, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-2-propyl-N-(5,5,5-trifluoropentyl)pentanamide is sourced from PubChem (CID 115519660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).