About ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate
ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate (PubChem CID 115519663) has the molecular formula C8H11F3N4O2
and a molecular weight of 252.20 g/mol. Its IUPAC name is ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate |
| PubChem CID | 115519663 |
| Molecular Formula | C8H11F3N4O2 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate |
| SMILES | CCOC(=O)c1nnnn1CCCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O2/c1-2-17-7(16)6-12-13-14-15(6)5-3-4-8(9,10)11/h2-5H2,1H3 |
| InChIKey | WAWCVVRJZHLIEV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate?
The IUPAC name of ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate (CID 115519663) is ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate.
What is the SMILES notation for ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate?
The canonical SMILES for ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate is CCOC(=O)c1nnnn1CCCC(F)(F)F.
What is the InChIKey of ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate?
The InChIKey is WAWCVVRJZHLIEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N4O2/c1-2-17-7(16)6-12-13-14-15(6)5-3-4-8(9,10)11/h2-5H2,1H3.
What are the key properties of ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate?
ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate has a molecular weight of 252.20 g/mol, XLogP of 1.19, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(4,4,4-trifluorobutyl)tetrazole-5-carboxylate is sourced from PubChem (CID 115519663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).