About 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole
4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole (PubChem CID 115519711) has the molecular formula C9H12F3IN2
and a molecular weight of 332.11 g/mol. Its IUPAC name is 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole.
Molecular Properties
| Compound Name | 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole |
| PubChem CID | 115519711 |
| Molecular Formula | C9H12F3IN2 |
| Molecular Weight | 332.11 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole |
| SMILES | Cc1nn(CCCC(F)(F)F)c(C)c1I |
| InChI | InChI=1S/C9H12F3IN2/c1-6-8(13)7(2)15(14-6)5-3-4-9(10,11)12/h3-5H2,1-2H3 |
| InChIKey | VLDHUBMZAZCERP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.11 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole?
The IUPAC name of 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole (CID 115519711) is 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole.
What is the SMILES notation for 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole?
The canonical SMILES for 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole is Cc1nn(CCCC(F)(F)F)c(C)c1I.
What is the InChIKey of 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole?
The InChIKey is VLDHUBMZAZCERP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3IN2/c1-6-8(13)7(2)15(14-6)5-3-4-9(10,11)12/h3-5H2,1-2H3.
What are the key properties of 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole?
4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole has a molecular weight of 332.11 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole is sourced from PubChem (CID 115519711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).