About 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline
4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline (PubChem CID 115519846) has the molecular formula C10H11BrF3NOS
and a molecular weight of 330.17 g/mol. Its IUPAC name is 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline.
Molecular Properties
| Compound Name | 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline |
| PubChem CID | 115519846 |
| Molecular Formula | C10H11BrF3NOS |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline |
| SMILES | Nc1ccc(Br)cc1S(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H11BrF3NOS/c11-7-2-3-8(15)9(6-7)17(16)5-1-4-10(12,13)14/h2-3,6H,1,4-5,15H2 |
| InChIKey | UINCMYHSNVVMBU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline?
The IUPAC name of 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline (CID 115519846) is 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline.
What is the SMILES notation for 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline?
The canonical SMILES for 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline is Nc1ccc(Br)cc1S(=O)CCCC(F)(F)F.
What is the InChIKey of 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline?
The InChIKey is UINCMYHSNVVMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrF3NOS/c11-7-2-3-8(15)9(6-7)17(16)5-1-4-10(12,13)14/h2-3,6H,1,4-5,15H2.
What are the key properties of 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline?
4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline has a molecular weight of 330.17 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(4,4,4-trifluorobutylsulfinyl)aniline is sourced from PubChem (CID 115519846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).