C9H14F3N3O2S — CID 115519864
3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide (PubChem CID 115519864) has the molecular formula C9H14F3N3O2S and a molecular weight of 285.29 g/mol. Its IUPAC name is 3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115519864 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3,5-dimethyl-1-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide |
| SMILES | Cc1nn(CCCC(F)(F)F)c(C)c1S(N)(=O)=O |
| InChI | InChI=1S/C9H14F3N3O2S/c1-6-8(18(13,16)17)7(2)15(14-6)5-3-4-9(10,11)12/h3-5H2,1-2H3,(H2,13,16,17) |
| InChIKey | MGWUOYWBEOATNK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |