About 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide
2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide (PubChem CID 115519865) has the molecular formula C7H13F3N2O2S2
and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide.
Molecular Properties
| Compound Name | 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide |
| PubChem CID | 115519865 |
| Molecular Formula | C7H13F3N2O2S2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide |
| SMILES | NC(=S)CS(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O2S2/c8-7(9,10)3-1-2-4-12-16(13,14)5-6(11)15/h12H,1-5H2,(H2,11,15) |
| InChIKey | UJEUAYFCXWDEBA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide?
The IUPAC name of 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide (CID 115519865) is 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide.
What is the SMILES notation for 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide?
The canonical SMILES for 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide is NC(=S)CS(=O)(=O)NCCCCC(F)(F)F.
What is the InChIKey of 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide?
The InChIKey is UJEUAYFCXWDEBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O2S2/c8-7(9,10)3-1-2-4-12-16(13,14)5-6(11)15/h12H,1-5H2,(H2,11,15).
What are the key properties of 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide?
2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide has a molecular weight of 278.32 g/mol, XLogP of 0.92, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5,5-trifluoropentylsulfamoyl)ethanethioamide is sourced from PubChem (CID 115519865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).