About 3-methylbutanal
3-methylbutanal (PubChem CID 11552) has the molecular formula C5H10O
and a molecular weight of 86.13 g/mol. Its IUPAC name is 3-methylbutanal.
Molecular Properties
| Compound Name | 3-methylbutanal |
| PubChem CID | 11552 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | 3-methylbutanal |
| SMILES | CC(C)CC=O |
| InChI | InChI=1S/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3 |
| InChIKey | YGHRJJRRZDOVPD-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanal?
The IUPAC name of 3-methylbutanal (CID 11552) is 3-methylbutanal.
What is the SMILES notation for 3-methylbutanal?
The canonical SMILES for 3-methylbutanal is CC(C)CC=O.
What is the InChIKey of 3-methylbutanal?
The InChIKey is YGHRJJRRZDOVPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3.
What are the key properties of 3-methylbutanal?
3-methylbutanal has a molecular weight of 86.13 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanal is sourced from PubChem (CID 11552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).