C10H12F3NO2 — CID 115520128
3-methyl-1-(5,5,5-trifluoropentyl)pyrrole-2,5-dione (PubChem CID 115520128) has the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-methyl-1-(5,5,5-trifluoropentyl)pyrrole-2,5-dione.
| Compound Name | 3-methyl-1-(5,5,5-trifluoropentyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 115520128 |
| Molecular Formula | C10H12F3NO2 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-methyl-1-(5,5,5-trifluoropentyl)pyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CCCCC(F)(F)F)C1=O |
| InChI | InChI=1S/C10H12F3NO2/c1-7-6-8(15)14(9(7)16)5-3-2-4-10(11,12)13/h6H,2-5H2,1H3 |
| InChIKey | FYCUXCJBNKREEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|