About N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine
N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine (PubChem CID 115520420) has the molecular formula C13H25F3N2O
and a molecular weight of 282.35 g/mol. Its IUPAC name is N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine.
Molecular Properties
| Compound Name | N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine |
| PubChem CID | 115520420 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine |
| SMILES | CCCNC1COCC1CNCCCCC(F)(F)F |
| InChI | InChI=1S/C13H25F3N2O/c1-2-6-18-12-10-19-9-11(12)8-17-7-4-3-5-13(14,15)16/h11-12,17-18H,2-10H2,1H3 |
| InChIKey | OUAUCMQKHBSJMI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine?
The IUPAC name of N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine (CID 115520420) is N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine.
What is the SMILES notation for N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine?
The canonical SMILES for N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine is CCCNC1COCC1CNCCCCC(F)(F)F.
What is the InChIKey of N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine?
The InChIKey is OUAUCMQKHBSJMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F3N2O/c1-2-6-18-12-10-19-9-11(12)8-17-7-4-3-5-13(14,15)16/h11-12,17-18H,2-10H2,1H3.
What are the key properties of N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine?
N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine has a molecular weight of 282.35 g/mol, XLogP of 2.32, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-4-[(5,5,5-trifluoropentylamino)methyl]oxolan-3-amine is sourced from PubChem (CID 115520420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).