C9H11F3N2O4 — CID 115520460
(E)-4-oxo-4-(4,4,4-trifluorobutylcarbamoylamino)but-2-enoic acid (PubChem CID 115520460) has the molecular formula C9H11F3N2O4 and a molecular weight of 268.19 g/mol. Its IUPAC name is (E)-4-oxo-4-(4,4,4-trifluorobutylcarbamoylamino)but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-(4,4,4-trifluorobutylcarbamoylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 115520460 |
| Molecular Formula | C9H11F3N2O4 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (E)-4-oxo-4-(4,4,4-trifluorobutylcarbamoylamino)but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O4/c10-9(11,12)4-1-5-13-8(18)14-6(15)2-3-7(16)17/h2-3H,1,4-5H2,(H,16,17)(H2,13,14,15,18)/b3-2+ |
| InChIKey | UMVHQWQLJRDGEY-NSCUHMNNSA-N |
| XLogP | 0.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|