C12H18F3N3O — CID 115520672
1-propan-2-yl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one (PubChem CID 115520672) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is 1-propan-2-yl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one.
| Compound Name | 1-propan-2-yl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 115520672 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 1-propan-2-yl-3-(5,5,5-trifluoropentylamino)pyrazin-2-one |
| SMILES | CC(C)n1ccnc(NCCCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C12H18F3N3O/c1-9(2)18-8-7-17-10(11(18)19)16-6-4-3-5-12(13,14)15/h7-9H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | PDCRDMHPZLGRHS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|