C13H19F3N4S — CID 115520854
1-methyl-3-propyl-6-(5,5,5-trifluoropentyl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 115520854) has the molecular formula C13H19F3N4S and a molecular weight of 320.38 g/mol. Its IUPAC name is 1-methyl-3-propyl-6-(5,5,5-trifluoropentyl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 1-methyl-3-propyl-6-(5,5,5-trifluoropentyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 115520854 |
| Molecular Formula | C13H19F3N4S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-methyl-3-propyl-6-(5,5,5-trifluoropentyl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | CCCc1nn(C)c2c1[nH]c(=S)n2CCCCC(F)(F)F |
| InChI | InChI=1S/C13H19F3N4S/c1-3-6-9-10-11(19(2)18-9)20(12(21)17-10)8-5-4-7-13(14,15)16/h3-8H2,1-2H3,(H,17,21) |
| InChIKey | UFMNNCGMCHJSBD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|