C12H18F3N5 — CID 115520904
3-ethyl-1-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazol-5-amine (PubChem CID 115520904) has the molecular formula C12H18F3N5 and a molecular weight of 289.31 g/mol. Its IUPAC name is 3-ethyl-1-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazol-5-amine.
| Compound Name | 3-ethyl-1-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazol-5-amine |
|---|---|
| PubChem CID | 115520904 |
| Molecular Formula | C12H18F3N5 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-ethyl-1-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazol-5-amine |
| SMILES | CCc1nn(C)c2c1nc(N)n2CCCCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N5/c1-3-8-9-10(19(2)18-8)20(11(16)17-9)7-5-4-6-12(13,14)15/h3-7H2,1-2H3,(H2,16,17) |
| InChIKey | QILZBEHVRCBBKN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|