C13H18ClF3N4 — CID 115521138
5-(chloromethyl)-1-ethyl-3-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazole (PubChem CID 115521138) has the molecular formula C13H18ClF3N4 and a molecular weight of 322.76 g/mol. Its IUPAC name is 5-(chloromethyl)-1-ethyl-3-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazole.
| Compound Name | 5-(chloromethyl)-1-ethyl-3-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazole |
|---|---|
| PubChem CID | 115521138 |
| Molecular Formula | C13H18ClF3N4 |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 5-(chloromethyl)-1-ethyl-3-methyl-6-(5,5,5-trifluoropentyl)imidazo[4,5-d]pyrazole |
| SMILES | CCn1nc(C)c2nc(CCl)n(CCCCC(F)(F)F)c21 |
| InChI | InChI=1S/C13H18ClF3N4/c1-3-21-12-11(9(2)19-21)18-10(8-14)20(12)7-5-4-6-13(15,16)17/h3-8H2,1-2H3 |
| InChIKey | DBXILQZCTVCLRF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|