C11H17F3N2O4 — CID 115521271
4-[methyl(4,4,4-trifluorobutylcarbamoyl)amino]oxolane-3-carboxylic acid (PubChem CID 115521271) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is 4-[methyl(4,4,4-trifluorobutylcarbamoyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[methyl(4,4,4-trifluorobutylcarbamoyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 115521271 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-[methyl(4,4,4-trifluorobutylcarbamoyl)amino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)NCCCC(F)(F)F)C1COCC1C(=O)O |
| InChI | InChI=1S/C11H17F3N2O4/c1-16(8-6-20-5-7(8)9(17)18)10(19)15-4-2-3-11(12,13)14/h7-8H,2-6H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | JJXRWXGRBHASBB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|