About 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid
1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid (PubChem CID 115521365) has the molecular formula C13H21F3N2O3
and a molecular weight of 310.32 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid |
| PubChem CID | 115521365 |
| Molecular Formula | C13H21F3N2O3 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid |
| SMILES | O=C(NCCCC(F)(F)F)NC1(C(=O)O)CCCCCC1 |
| InChI | InChI=1S/C13H21F3N2O3/c14-13(15,16)8-5-9-17-11(21)18-12(10(19)20)6-3-1-2-4-7-12/h1-9H2,(H,19,20)(H2,17,18,21) |
| InChIKey | HNYDGDUCUPTGSI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid?
The IUPAC name of 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid (CID 115521365) is 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid.
What is the SMILES notation for 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid?
The canonical SMILES for 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid is O=C(NCCCC(F)(F)F)NC1(C(=O)O)CCCCCC1.
What is the InChIKey of 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid?
The InChIKey is HNYDGDUCUPTGSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3N2O3/c14-13(15,16)8-5-9-17-11(21)18-12(10(19)20)6-3-1-2-4-7-12/h1-9H2,(H,19,20)(H2,17,18,21).
What are the key properties of 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid?
1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid has a molecular weight of 310.32 g/mol, XLogP of 2.81, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4,4-trifluorobutylcarbamoylamino)cycloheptane-1-carboxylic acid is sourced from PubChem (CID 115521365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).