About (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid
(3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid (PubChem CID 115521395) has the molecular formula C12H19F3N2O3
and a molecular weight of 296.29 g/mol. Its IUPAC name is (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid |
| PubChem CID | 115521395 |
| Molecular Formula | C12H19F3N2O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)NCCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3N2O3/c13-12(14,15)5-1-2-6-16-11(20)17-7-3-4-9(8-17)10(18)19/h9H,1-8H2,(H,16,20)(H,18,19)/t9-/m0/s1 |
| InChIKey | FGCWKVJDNADKLH-VIFPVBQESA-N |
| XLogP | 2.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid (CID 115521395) is (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid is O=C(O)[C@H]1CCCN(C(=O)NCCCCC(F)(F)F)C1.
What is the InChIKey of (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid?
The InChIKey is FGCWKVJDNADKLH-VIFPVBQESA-N. The full InChI is InChI=1S/C12H19F3N2O3/c13-12(14,15)5-1-2-6-16-11(20)17-7-3-4-9(8-17)10(18)19/h9H,1-8H2,(H,16,20)(H,18,19)/t9-/m0/s1.
What are the key properties of (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid?
(3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid has a molecular weight of 296.29 g/mol, XLogP of 2.23, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(5,5,5-trifluoropentylcarbamoyl)piperidine-3-carboxylic acid is sourced from PubChem (CID 115521395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).