C10H12ClF3N2OS — CID 115521513
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4,4,4-trifluorobutyl)acetamide (PubChem CID 115521513) has the molecular formula C10H12ClF3N2OS and a molecular weight of 300.73 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4,4,4-trifluorobutyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4,4,4-trifluorobutyl)acetamide |
|---|---|
| PubChem CID | 115521513 |
| Molecular Formula | C10H12ClF3N2OS |
| Molecular Weight | 300.73 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(4,4,4-trifluorobutyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3N2OS/c11-5-7-6-18-9(16-7)4-8(17)15-3-1-2-10(12,13)14/h6H,1-5H2,(H,15,17) |
| InChIKey | BPVQBLSTRQXSJG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|