C11H14ClF3N2OS — CID 115521514
2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(5,5,5-trifluoropentyl)acetamide (PubChem CID 115521514) has the molecular formula C11H14ClF3N2OS and a molecular weight of 314.76 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(5,5,5-trifluoropentyl)acetamide.
| Compound Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(5,5,5-trifluoropentyl)acetamide |
|---|---|
| PubChem CID | 115521514 |
| Molecular Formula | C11H14ClF3N2OS |
| Molecular Weight | 314.76 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-[4-(chloromethyl)-1,3-thiazol-2-yl]-N-(5,5,5-trifluoropentyl)acetamide |
| SMILES | O=C(Cc1nc(CCl)cs1)NCCCCC(F)(F)F |
| InChI | InChI=1S/C11H14ClF3N2OS/c12-6-8-7-19-10(17-8)5-9(18)16-4-2-1-3-11(13,14)15/h7H,1-6H2,(H,16,18) |
| InChIKey | DPVLFAGJSGZNMM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|