About 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione
5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione (PubChem CID 115521526) has the molecular formula C9H13F3N2S
and a molecular weight of 238.28 g/mol. Its IUPAC name is 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
| PubChem CID | 115521526 |
| Molecular Formula | C9H13F3N2S |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
| SMILES | Cc1cn(CCCCC(F)(F)F)c(=S)[nH]1 |
| InChI | InChI=1S/C9H13F3N2S/c1-7-6-14(8(15)13-7)5-3-2-4-9(10,11)12/h6H,2-5H2,1H3,(H,13,15) |
| InChIKey | WACPQVCPAUPPAG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
The IUPAC name of 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione (CID 115521526) is 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione.
What is the SMILES notation for 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
The canonical SMILES for 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione is Cc1cn(CCCCC(F)(F)F)c(=S)[nH]1.
What is the InChIKey of 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
The InChIKey is WACPQVCPAUPPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3N2S/c1-7-6-14(8(15)13-7)5-3-2-4-9(10,11)12/h6H,2-5H2,1H3,(H,13,15).
What are the key properties of 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione has a molecular weight of 238.28 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione is sourced from PubChem (CID 115521526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).