About 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione
4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione (PubChem CID 115521529) has the molecular formula C12H19F3N2S
and a molecular weight of 280.36 g/mol. Its IUPAC name is 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
| PubChem CID | 115521529 |
| Molecular Formula | C12H19F3N2S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione |
| SMILES | CC(C)(C)c1c[nH]c(=S)n1CCCCC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2S/c1-11(2,3)9-8-16-10(18)17(9)7-5-4-6-12(13,14)15/h8H,4-7H2,1-3H3,(H,16,18) |
| InChIKey | DKZXOGBTQQDJDS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
The IUPAC name of 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione (CID 115521529) is 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione.
What is the SMILES notation for 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
The canonical SMILES for 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione is CC(C)(C)c1c[nH]c(=S)n1CCCCC(F)(F)F.
What is the InChIKey of 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
The InChIKey is DKZXOGBTQQDJDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3N2S/c1-11(2,3)9-8-16-10(18)17(9)7-5-4-6-12(13,14)15/h8H,4-7H2,1-3H3,(H,16,18).
What are the key properties of 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione?
4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione has a molecular weight of 280.36 g/mol, XLogP of 4.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3-(5,5,5-trifluoropentyl)-1H-imidazole-2-thione is sourced from PubChem (CID 115521529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).